C18H30O4 — CID 10913929
methyl (2E,6E)-3-(dimethoxymethyl)-7,11-dimethyldodeca-2,6,10-trienoate (PubChem CID 10913929) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is methyl (2E,6E)-3-(dimethoxymethyl)-7,11-dimethyldodeca-2,6,10-trienoate.
| Compound Name | methyl (2E,6E)-3-(dimethoxymethyl)-7,11-dimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 10913929 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | methyl (2E,6E)-3-(dimethoxymethyl)-7,11-dimethyldodeca-2,6,10-trienoate |
| SMILES | COC(=O)/C=C(\CC/C=C(\C)CCC=C(C)C)C(OC)OC |
| InChI | InChI=1S/C18H30O4/c1-14(2)9-7-10-15(3)11-8-12-16(13-17(19)20-4)18(21-5)22-6/h9,11,13,18H,7-8,10,12H2,1-6H3/b15-11+,16-13+ |
| InChIKey | GVAUPKSNNFHSCR-NWFDBUFXSA-N |
| XLogP | 4.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|