C23H26BrNO4 — CID 16757309
N-[3-(2-bromo-4,5-dimethoxyphenyl)propyl]-N-[(4-methoxyphenyl)methyl]but-2-ynamide (PubChem CID 16757309) has the molecular formula C23H26BrNO4 and a molecular weight of 460.37 g/mol. Its IUPAC name is N-[3-(2-bromo-4,5-dimethoxyphenyl)propyl]-N-[(4-methoxyphenyl)methyl]but-2-ynamide.
| Compound Name | N-[3-(2-bromo-4,5-dimethoxyphenyl)propyl]-N-[(4-methoxyphenyl)methyl]but-2-ynamide |
|---|---|
| PubChem CID | 16757309 |
| Molecular Formula | C23H26BrNO4 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | N-[3-(2-bromo-4,5-dimethoxyphenyl)propyl]-N-[(4-methoxyphenyl)methyl]but-2-ynamide |
| SMILES | CC#CC(=O)N(CCCc1cc(OC)c(OC)cc1Br)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H26BrNO4/c1-5-7-23(26)25(16-17-9-11-19(27-2)12-10-17)13-6-8-18-14-21(28-3)22(29-4)15-20(18)24/h9-12,14-15H,6,8,13,16H2,1-4H3 |
| InChIKey | HUEXCHQPJKDBJT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|