C24H37N5O4SSi — CID 167580199
5-(5-methyl-1,3,4-oxadiazol-2-yl)-N-[3-(propylsulfonylmethyl)cyclobutyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 167580199) has the molecular formula C24H37N5O4SSi and a molecular weight of 519.74 g/mol. Its IUPAC name is 5-(5-methyl-1,3,4-oxadiazol-2-yl)-N-[3-(propylsulfonylmethyl)cyclobutyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 5-(5-methyl-1,3,4-oxadiazol-2-yl)-N-[3-(propylsulfonylmethyl)cyclobutyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 167580199 |
| Molecular Formula | C24H37N5O4SSi |
| Molecular Weight | 519.74 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 5-(5-methyl-1,3,4-oxadiazol-2-yl)-N-[3-(propylsulfonylmethyl)cyclobutyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | CCCS(=O)(=O)CC1CC(Nc2c(-c3nnc(C)o3)cnc3c2ccn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C24H37N5O4SSi/c1-6-10-34(30,31)15-18-12-19(13-18)26-22-20-7-8-29(16-32-9-11-35(3,4)5)23(20)25-14-21(22)24-28-27-17(2)33-24/h7-8,14,18-19H,6,9-13,15-16H2,1-5H3,(H,25,26) |
| InChIKey | DWTQIIYRXZZYLB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|