C24H17Cl2NOS2 — CID 167581161
2-(2-chloro-6-methoxy-1-benzothiophen-3-yl)-6-(2-chloro-6-methyl-1-benzothiophen-3-yl)aniline (PubChem CID 167581161) has the molecular formula C24H17Cl2NOS2 and a molecular weight of 470.45 g/mol. Its IUPAC name is 2-(2-chloro-6-methoxy-1-benzothiophen-3-yl)-6-(2-chloro-6-methyl-1-benzothiophen-3-yl)aniline.
| Compound Name | 2-(2-chloro-6-methoxy-1-benzothiophen-3-yl)-6-(2-chloro-6-methyl-1-benzothiophen-3-yl)aniline |
|---|---|
| PubChem CID | 167581161 |
| Molecular Formula | C24H17Cl2NOS2 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | 2-(2-chloro-6-methoxy-1-benzothiophen-3-yl)-6-(2-chloro-6-methyl-1-benzothiophen-3-yl)aniline |
| SMILES | COc1ccc2c(-c3cccc(-c4c(Cl)sc5cc(C)ccc45)c3N)c(Cl)sc2c1 |
| InChI | InChI=1S/C24H17Cl2NOS2/c1-12-6-8-14-18(10-12)29-23(25)20(14)16-4-3-5-17(22(16)27)21-15-9-7-13(28-2)11-19(15)30-24(21)26/h3-11H,27H2,1-2H3 |
| InChIKey | GVAOBEHKHBOIEO-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|