C27H33F2N3O3 — CID 167582278
(2R)-N-[(1-aminoisoquinolin-6-yl)methyl]-5-butoxy-2-[(3,4-difluorophenyl)methyl]-4-oxopentanamide;methane (PubChem CID 167582278) has the molecular formula C27H33F2N3O3 and a molecular weight of 485.58 g/mol. Its IUPAC name is (2R)-N-[(1-aminoisoquinolin-6-yl)methyl]-5-butoxy-2-[(3,4-difluorophenyl)methyl]-4-oxopentanamide;methane.
| Compound Name | (2R)-N-[(1-aminoisoquinolin-6-yl)methyl]-5-butoxy-2-[(3,4-difluorophenyl)methyl]-4-oxopentanamide;methane |
|---|---|
| PubChem CID | 167582278 |
| Molecular Formula | C27H33F2N3O3 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (2R)-N-[(1-aminoisoquinolin-6-yl)methyl]-5-butoxy-2-[(3,4-difluorophenyl)methyl]-4-oxopentanamide;methane |
| SMILES | C.CCCCOCC(=O)C[C@@H](Cc1ccc(F)c(F)c1)C(=O)NCc1ccc2c(N)nccc2c1 |
| InChI | InChI=1S/C26H29F2N3O3.CH4/c1-2-3-10-34-16-21(32)14-20(11-17-5-7-23(27)24(28)13-17)26(33)31-15-18-4-6-22-19(12-18)8-9-30-25(22)29;/h4-9,12-13,20H,2-3,10-11,14-16H2,1H3,(H2,29,30)(H,31,33);1H4/t20-;/m1./s1 |
| InChIKey | HIHXSGYAIBUSBK-VEIFNGETSA-N |
| XLogP | 4.98 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|