C27H34FN5O2 — CID 167583471
1-[6-fluoro-2-methoxy-5-[4-(1-methylazetidin-3-yl)piperazin-1-yl]benzimidazol-1-yl]-5-phenylpentan-1-one (PubChem CID 167583471) has the molecular formula C27H34FN5O2 and a molecular weight of 479.60 g/mol. Its IUPAC name is 1-[6-fluoro-2-methoxy-5-[4-(1-methylazetidin-3-yl)piperazin-1-yl]benzimidazol-1-yl]-5-phenylpentan-1-one.
| Compound Name | 1-[6-fluoro-2-methoxy-5-[4-(1-methylazetidin-3-yl)piperazin-1-yl]benzimidazol-1-yl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 167583471 |
| Molecular Formula | C27H34FN5O2 |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 1-[6-fluoro-2-methoxy-5-[4-(1-methylazetidin-3-yl)piperazin-1-yl]benzimidazol-1-yl]-5-phenylpentan-1-one |
| SMILES | COc1nc2cc(N3CCN(C4CN(C)C4)CC3)c(F)cc2n1C(=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C27H34FN5O2/c1-30-18-21(19-30)31-12-14-32(15-13-31)24-17-23-25(16-22(24)28)33(27(29-23)35-2)26(34)11-7-6-10-20-8-4-3-5-9-20/h3-5,8-9,16-17,21H,6-7,10-15,18-19H2,1-2H3 |
| InChIKey | HMHFDBNYHMTVIW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|