C9H21NO6P- — CID 167585419
[6-amino-2-(methoxymethyl)hexyl] methoxy phosphate (PubChem CID 167585419) has the molecular formula C9H21NO6P- and a molecular weight of 270.24 g/mol. Its IUPAC name is [6-amino-2-(methoxymethyl)hexyl] methoxy phosphate.
| Compound Name | [6-amino-2-(methoxymethyl)hexyl] methoxy phosphate |
|---|---|
| PubChem CID | 167585419 |
| Molecular Formula | C9H21NO6P- |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [6-amino-2-(methoxymethyl)hexyl] methoxy phosphate |
| SMILES | COCC(CCCCN)COP(=O)([O-])OOC |
| InChI | InChI=1S/C9H22NO6P/c1-13-7-9(5-3-4-6-10)8-15-17(11,12)16-14-2/h9H,3-8,10H2,1-2H3,(H,11,12)/p-1 |
| InChIKey | HSTLNEPBEWYDBA-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|