C15H32B2O4 — CID 167588217
2-propan-2-yl-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane (PubChem CID 167588217) has the molecular formula C15H32B2O4 and a molecular weight of 298.04 g/mol. Its IUPAC name is 2-propan-2-yl-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane.
| Compound Name | 2-propan-2-yl-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 167588217 |
| Molecular Formula | C15H32B2O4 |
| Molecular Weight | 298.04 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 2-propan-2-yl-1,3,2-dioxaborinane;4,4,5,5-tetramethyl-2-propan-2-yl-1,3,2-dioxaborolane |
| SMILES | CC(C)B1OC(C)(C)C(C)(C)O1.CC(C)B1OCCCO1 |
| InChI | InChI=1S/C9H19BO2.C6H13BO2/c1-7(2)10-11-8(3,4)9(5,6)12-10;1-6(2)7-8-4-3-5-9-7/h7H,1-6H3;6H,3-5H2,1-2H3 |
| InChIKey | IBPOBQWGZXQLCR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.04 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|