C9H18BO4- — CID 59259707
2,2,3,3-tetramethyl-1,4,7,10-tetraoxa-5-boranuidaspiro[4.5]decane (PubChem CID 59259707) has the molecular formula C9H18BO4- and a molecular weight of 201.05 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-1,4,7,10-tetraoxa-5-boranuidaspiro[4.5]decane.
| Compound Name | 2,2,3,3-tetramethyl-1,4,7,10-tetraoxa-5-boranuidaspiro[4.5]decane |
|---|---|
| PubChem CID | 59259707 |
| Molecular Formula | C9H18BO4- |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2,2,3,3-tetramethyl-1,4,7,10-tetraoxa-5-boranuidaspiro[4.5]decane |
| SMILES | CC1(C)O[B-]2(COCCO2)OC1(C)C |
| InChI | InChI=1S/C9H18BO4/c1-8(2)9(3,4)14-10(13-8)7-11-5-6-12-10/h5-7H2,1-4H3/q-1 |
| InChIKey | SCPAVTVXLYNVHO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|