C23H28O7 — CID 16758844
methyl 4-[[2-(ethoxycarbonyloxymethyl)-6-hex-1-ynyl-3,6-dihydro-2H-pyran-3-yl]oxy]benzoate (PubChem CID 16758844) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is methyl 4-[[2-(ethoxycarbonyloxymethyl)-6-hex-1-ynyl-3,6-dihydro-2H-pyran-3-yl]oxy]benzoate.
| Compound Name | methyl 4-[[2-(ethoxycarbonyloxymethyl)-6-hex-1-ynyl-3,6-dihydro-2H-pyran-3-yl]oxy]benzoate |
|---|---|
| PubChem CID | 16758844 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | methyl 4-[[2-(ethoxycarbonyloxymethyl)-6-hex-1-ynyl-3,6-dihydro-2H-pyran-3-yl]oxy]benzoate |
| SMILES | CCCCC#CC1C=CC(Oc2ccc(C(=O)OC)cc2)C(COC(=O)OCC)O1 |
| InChI | InChI=1S/C23H28O7/c1-4-6-7-8-9-18-14-15-20(21(30-18)16-28-23(25)27-5-2)29-19-12-10-17(11-13-19)22(24)26-3/h10-15,18,20-21H,4-7,16H2,1-3H3 |
| InChIKey | SSNMLAQMLRWUHU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|