C21H32N2 — CID 167591291
2-methyl-N-[(1S)-1-phenylethyl]butan-1-amine;(1S)-1-phenylethanamine (PubChem CID 167591291) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-1-phenylethyl]butan-1-amine;(1S)-1-phenylethanamine.
| Compound Name | 2-methyl-N-[(1S)-1-phenylethyl]butan-1-amine;(1S)-1-phenylethanamine |
|---|---|
| PubChem CID | 167591291 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | 2-methyl-N-[(1S)-1-phenylethyl]butan-1-amine;(1S)-1-phenylethanamine |
| SMILES | CCC(C)CN[C@@H](C)c1ccccc1.C[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C13H21N.C8H11N/c1-4-11(2)10-14-12(3)13-8-6-5-7-9-13;1-7(9)8-5-3-2-4-6-8/h5-9,11-12,14H,4,10H2,1-3H3;2-7H,9H2,1H3/t11?,12-;7-/m00/s1 |
| InChIKey | ILUUHTQIWZIZLF-PDUCYPADSA-N |
| XLogP | 5.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |