C36H49IN2O8 — CID 167591587
tert-butyl 8,10-dioxo-3-azaspiro[5.5]undecane-3-carboxylate;tert-butyl 8,10-dioxo-9-(phenyl-λ3-iodanylidene)-3-azaspiro[5.5]undecane-3-carboxylate (PubChem CID 167591587) has the molecular formula C36H49IN2O8 and a molecular weight of 764.70 g/mol. Its IUPAC name is tert-butyl 8,10-dioxo-3-azaspiro[5.5]undecane-3-carboxylate;tert-butyl 8,10-dioxo-9-(phenyl-λ3-iodanylidene)-3-azaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 8,10-dioxo-3-azaspiro[5.5]undecane-3-carboxylate;tert-butyl 8,10-dioxo-9-(phenyl-λ3-iodanylidene)-3-azaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 167591587 |
| Molecular Formula | C36H49IN2O8 |
| Molecular Weight | 764.70 g/mol |
| Exact Mass | 764.25 |
| IUPAC Name | tert-butyl 8,10-dioxo-3-azaspiro[5.5]undecane-3-carboxylate;tert-butyl 8,10-dioxo-9-(phenyl-λ3-iodanylidene)-3-azaspiro[5.5]undecane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)C(=Ic1ccccc1)C(=O)C2.CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)CC(=O)C2 |
| InChI | InChI=1S/C21H26INO4.C15H23NO4/c1-20(2,3)27-19(26)23-11-9-21(10-12-23)13-16(24)18(17(25)14-21)22-15-7-5-4-6-8-15;1-14(2,3)20-13(19)16-6-4-15(5-7-16)9-11(17)8-12(18)10-15/h4-8H,9-14H2,1-3H3;4-10H2,1-3H3 |
| InChIKey | IMXBCZNXFBJFOP-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.70 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|