C24H36N2O2 — CID 67354921
tert-butyl 9-(azetidin-1-yl)-9-phenyl-3-azaspiro[5.5]undecane-3-carboxylate (PubChem CID 67354921) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is tert-butyl 9-(azetidin-1-yl)-9-phenyl-3-azaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 9-(azetidin-1-yl)-9-phenyl-3-azaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 67354921 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | tert-butyl 9-(azetidin-1-yl)-9-phenyl-3-azaspiro[5.5]undecane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CCC(c1ccccc1)(N1CCC1)CC2 |
| InChI | InChI=1S/C24H36N2O2/c1-22(2,3)28-21(27)25-18-14-23(15-19-25)10-12-24(13-11-23,26-16-7-17-26)20-8-5-4-6-9-20/h4-6,8-9H,7,10-19H2,1-3H3 |
| InChIKey | RYHJTOXWTAMFHK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |