C21H18F3NO2 — CID 167591709
N-[3-[2-[3-(trifluoromethyl)phenyl]acetyl]-2,3-dihydro-1H-inden-1-yl]prop-2-enamide (PubChem CID 167591709) has the molecular formula C21H18F3NO2 and a molecular weight of 373.37 g/mol. Its IUPAC name is N-[3-[2-[3-(trifluoromethyl)phenyl]acetyl]-2,3-dihydro-1H-inden-1-yl]prop-2-enamide.
| Compound Name | N-[3-[2-[3-(trifluoromethyl)phenyl]acetyl]-2,3-dihydro-1H-inden-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 167591709 |
| Molecular Formula | C21H18F3NO2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-[3-[2-[3-(trifluoromethyl)phenyl]acetyl]-2,3-dihydro-1H-inden-1-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC(C(=O)Cc2cccc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C21H18F3NO2/c1-2-20(27)25-18-12-17(15-8-3-4-9-16(15)18)19(26)11-13-6-5-7-14(10-13)21(22,23)24/h2-10,17-18H,1,11-12H2,(H,25,27) |
| InChIKey | UHVOBZZZOBVQCS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|