C17H15N3O4S — CID 167595416
2-[(6-methyl-3-sulfamoylquinolin-4-yl)amino]benzoic acid (PubChem CID 167595416) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[(6-methyl-3-sulfamoylquinolin-4-yl)amino]benzoic acid.
| Compound Name | 2-[(6-methyl-3-sulfamoylquinolin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 167595416 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[(6-methyl-3-sulfamoylquinolin-4-yl)amino]benzoic acid |
| SMILES | Cc1ccc2ncc(S(N)(=O)=O)c(Nc3ccccc3C(=O)O)c2c1 |
| InChI | InChI=1S/C17H15N3O4S/c1-10-6-7-13-12(8-10)16(15(9-19-13)25(18,23)24)20-14-5-3-2-4-11(14)17(21)22/h2-9H,1H3,(H,19,20)(H,21,22)(H2,18,23,24) |
| InChIKey | ZHQVSMSGPJGGAK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |