C25H24N2O3 — CID 167598899
(10aS)-2-benzyl-3-[(3,4-dihydroxyphenyl)methyl]-3,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-1-one (PubChem CID 167598899) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is (10aS)-2-benzyl-3-[(3,4-dihydroxyphenyl)methyl]-3,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-1-one.
| Compound Name | (10aS)-2-benzyl-3-[(3,4-dihydroxyphenyl)methyl]-3,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-1-one |
|---|---|
| PubChem CID | 167598899 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (10aS)-2-benzyl-3-[(3,4-dihydroxyphenyl)methyl]-3,5,10,10a-tetrahydroimidazo[1,5-b]isoquinolin-1-one |
| SMILES | O=C1[C@@H]2Cc3ccccc3CN2C(Cc2ccc(O)c(O)c2)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H24N2O3/c28-22-11-10-18(12-23(22)29)13-24-26-16-20-9-5-4-8-19(20)14-21(26)25(30)27(24)15-17-6-2-1-3-7-17/h1-12,21,24,28-29H,13-16H2/t21-,24?/m0/s1 |
| InChIKey | XPIFUEOVWGVISN-XEGCMXMBSA-N |
| XLogP | 3.44 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|