C32H37FN6O — CID 167599063
4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(5,6-dimethyl-1H-indol-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 167599063) has the molecular formula C32H37FN6O and a molecular weight of 540.69 g/mol. Its IUPAC name is 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(5,6-dimethyl-1H-indol-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(5,6-dimethyl-1H-indol-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 167599063 |
| Molecular Formula | C32H37FN6O |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(5,6-dimethyl-1H-indol-4-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | Cc1cc2[nH]ccc2c(-c2ncc3c(N4CC5CCC(C5)C4)nc(OCC45CCCN4CCC5)nc3c2F)c1C |
| InChI | InChI=1S/C32H37FN6O/c1-19-13-25-23(7-10-34-25)26(20(19)2)29-27(33)28-24(15-35-29)30(38-16-21-5-6-22(14-21)17-38)37-31(36-28)40-18-32-8-3-11-39(32)12-4-9-32/h7,10,13,15,21-22,34H,3-6,8-9,11-12,14,16-18H2,1-2H3 |
| InChIKey | JMBUMQHTZHVNQH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |