C27H27F2N3O5 — CID 167604828
[2-[4-[6-amino-5-(3-methylbutanoyl)-3-pyridinyl]-N-hydroxy-3-methylanilino]-1-(3,5-difluorophenyl)-2-oxoethyl] acetate (PubChem CID 167604828) has the molecular formula C27H27F2N3O5 and a molecular weight of 511.53 g/mol. Its IUPAC name is [2-[4-[6-amino-5-(3-methylbutanoyl)-3-pyridinyl]-N-hydroxy-3-methylanilino]-1-(3,5-difluorophenyl)-2-oxoethyl] acetate.
| Compound Name | [2-[4-[6-amino-5-(3-methylbutanoyl)-3-pyridinyl]-N-hydroxy-3-methylanilino]-1-(3,5-difluorophenyl)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 167604828 |
| Molecular Formula | C27H27F2N3O5 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | [2-[4-[6-amino-5-(3-methylbutanoyl)-3-pyridinyl]-N-hydroxy-3-methylanilino]-1-(3,5-difluorophenyl)-2-oxoethyl] acetate |
| SMILES | CC(=O)OC(C(=O)N(O)c1ccc(-c2cnc(N)c(C(=O)CC(C)C)c2)c(C)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C27H27F2N3O5/c1-14(2)7-24(34)23-11-18(13-31-26(23)30)22-6-5-21(8-15(22)3)32(36)27(35)25(37-16(4)33)17-9-19(28)12-20(29)10-17/h5-6,8-14,25,36H,7H2,1-4H3,(H2,30,31) |
| InChIKey | XEGJJENQLOIRQD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 122.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|