C23H37B2N6O4 — CID 167609788
CID 167609788 (PubChem CID 167609788) has the molecular formula C23H37B2N6O4 and a molecular weight of 484.22 g/mol.
| Compound Name | CID 167609788 |
|---|---|
| PubChem CID | 167609788 |
| Molecular Formula | C23H37B2N6O4 |
| Molecular Weight | 484.22 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | — |
| SMILES | [2H]N(C[B][B])c1nc(O[C@@H](C)CCC)nn2c(C(O)C3CCN(C(=O)OC(C)(C)C)CC3C)cnc12 |
| InChI | InChI=1S/C23H37B2N6O4/c1-7-8-15(3)34-21-28-19(27-13-25-24)20-26-11-17(31(20)29-21)18(32)16-9-10-30(12-14(16)2)22(33)35-23(4,5)6/h11,14-16,18,32H,7-10,12-13H2,1-6H3,(H,27,28,29)/t14?,15-,16?,18?/m0/s1/i/hD |
| InChIKey | SYIJSEKVOVWOBK-ZCGHIWPUSA-N |
| XLogP | 2.78 |
| TPSA | 114.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|