C22H35B2N6O3 — CID 167654833
CID 167654833 (PubChem CID 167654833) has the molecular formula C22H35B2N6O3 and a molecular weight of 454.19 g/mol.
| Compound Name | CID 167654833 |
|---|---|
| PubChem CID | 167654833 |
| Molecular Formula | C22H35B2N6O3 |
| Molecular Weight | 454.19 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | — |
| SMILES | [2H]N(C[B][B])c1nc(O[C@@H](C)CCC)nn2c(CC3CCCCN3C(=O)OC(C)(C)C)cnc12 |
| InChI | InChI=1S/C22H35B2N6O3/c1-6-9-15(2)32-20-27-18(26-14-24-23)19-25-13-17(30(19)28-20)12-16-10-7-8-11-29(16)21(31)33-22(3,4)5/h13,15-16H,6-12,14H2,1-5H3,(H,26,27,28)/t15-,16?/m0/s1/i/hD |
| InChIKey | DVVWMZSSIKGAAK-DCYDQNGXSA-N |
| XLogP | 3.18 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.19 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|