C14H12BF3N4O — CID 167609932
N-[6-cyano-5-[[4-(trifluoromethyl)phenyl]methyl]pyrazin-2-yl]-methylboronamidic acid (PubChem CID 167609932) has the molecular formula C14H12BF3N4O and a molecular weight of 320.08 g/mol. Its IUPAC name is N-[6-cyano-5-[[4-(trifluoromethyl)phenyl]methyl]pyrazin-2-yl]-methylboronamidic acid.
| Compound Name | N-[6-cyano-5-[[4-(trifluoromethyl)phenyl]methyl]pyrazin-2-yl]-methylboronamidic acid |
|---|---|
| PubChem CID | 167609932 |
| Molecular Formula | C14H12BF3N4O |
| Molecular Weight | 320.08 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-[6-cyano-5-[[4-(trifluoromethyl)phenyl]methyl]pyrazin-2-yl]-methylboronamidic acid |
| SMILES | CB(O)Nc1cnc(Cc2ccc(C(F)(F)F)cc2)c(C#N)n1 |
| InChI | InChI=1S/C14H12BF3N4O/c1-15(23)22-13-8-20-11(12(7-19)21-13)6-9-2-4-10(5-3-9)14(16,17)18/h2-5,8,23H,6H2,1H3,(H,21,22) |
| InChIKey | UXUYIFLJMRUGTE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.08 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|