C12H12F3N5 — CID 90898420
6-[[4-(trifluoromethyl)phenyl]methyl]pyrimidine-2,4,5-triamine (PubChem CID 90898420) has the molecular formula C12H12F3N5 and a molecular weight of 283.26 g/mol. Its IUPAC name is 6-[[4-(trifluoromethyl)phenyl]methyl]pyrimidine-2,4,5-triamine.
| Compound Name | 6-[[4-(trifluoromethyl)phenyl]methyl]pyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 90898420 |
| Molecular Formula | C12H12F3N5 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 6-[[4-(trifluoromethyl)phenyl]methyl]pyrimidine-2,4,5-triamine |
| SMILES | Nc1nc(N)c(N)c(Cc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C12H12F3N5/c13-12(14,15)7-3-1-6(2-4-7)5-8-9(16)10(17)20-11(18)19-8/h1-4H,5,16H2,(H4,17,18,19,20) |
| InChIKey | SQPCEZHAVIXHQR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |