C15H11F3N4O — CID 167925836
5-cyano-N-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrazine-2-carboxamide (PubChem CID 167925836) has the molecular formula C15H11F3N4O and a molecular weight of 320.27 g/mol. Its IUPAC name is 5-cyano-N-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrazine-2-carboxamide.
| Compound Name | 5-cyano-N-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167925836 |
| Molecular Formula | C15H11F3N4O |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 5-cyano-N-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrazine-2-carboxamide |
| SMILES | N#Cc1cnc(C(=O)NCCc2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C15H11F3N4O/c16-15(17,18)11-3-1-10(2-4-11)5-6-20-14(23)13-9-21-12(7-19)8-22-13/h1-4,8-9H,5-6H2,(H,20,23) |
| InChIKey | MWDISFIZYFARBA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |