C9H10ClN5O5S — CID 16761096
2-chloro-N-[4-(diaminomethylideneamino)sulfonyl-2-nitrophenyl]acetamide (PubChem CID 16761096) has the molecular formula C9H10ClN5O5S and a molecular weight of 335.73 g/mol. Its IUPAC name is 2-chloro-N-[4-(diaminomethylideneamino)sulfonyl-2-nitrophenyl]acetamide.
| Compound Name | 2-chloro-N-[4-(diaminomethylideneamino)sulfonyl-2-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 16761096 |
| Molecular Formula | C9H10ClN5O5S |
| Molecular Weight | 335.73 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 2-chloro-N-[4-(diaminomethylideneamino)sulfonyl-2-nitrophenyl]acetamide |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(NC(=O)CCl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10ClN5O5S/c10-4-8(16)13-6-2-1-5(3-7(6)15(17)18)21(19,20)14-9(11)12/h1-3H,4H2,(H,13,16)(H4,11,12,14) |
| InChIKey | PJMAWINPNNIDKW-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.73 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|