C20H21NO7S — CID 167612176
methyl 2-[3-methoxy-1-[(4-methylphenyl)sulfonyl-prop-2-enylamino]-3-oxoprop-1-en-2-yl]furan-3-carboxylate (PubChem CID 167612176) has the molecular formula C20H21NO7S and a molecular weight of 419.46 g/mol. Its IUPAC name is methyl 2-[3-methoxy-1-[(4-methylphenyl)sulfonyl-prop-2-enylamino]-3-oxoprop-1-en-2-yl]furan-3-carboxylate.
| Compound Name | methyl 2-[3-methoxy-1-[(4-methylphenyl)sulfonyl-prop-2-enylamino]-3-oxoprop-1-en-2-yl]furan-3-carboxylate |
|---|---|
| PubChem CID | 167612176 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | methyl 2-[3-methoxy-1-[(4-methylphenyl)sulfonyl-prop-2-enylamino]-3-oxoprop-1-en-2-yl]furan-3-carboxylate |
| SMILES | C=CCN(C=C(C(=O)OC)c1occc1C(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO7S/c1-5-11-21(29(24,25)15-8-6-14(2)7-9-15)13-17(20(23)27-4)18-16(10-12-28-18)19(22)26-3/h5-10,12-13H,1,11H2,2-4H3 |
| InChIKey | KYUMQWGBCFRYOU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|