About methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen
methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen (PubChem CID 167618862) has the molecular formula C10H25BrO2S2
and a molecular weight of 321.35 g/mol. Its IUPAC name is methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen.
Molecular Properties
| Compound Name | methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen |
| PubChem CID | 167618862 |
| Molecular Formula | C10H25BrO2S2 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen |
| SMILES | COC(=O)c1ccsc1-c1sccc1Br.[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C10H7BrO2S2.9H2/c1-13-10(12)6-2-4-14-8(6)9-7(11)3-5-15-9;;;;;;;;;/h2-5H,1H3;9*1H |
| InChIKey | MDLAUBLANAOCJE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen?
The IUPAC name of methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen (CID 167618862) is methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen.
What is the SMILES notation for methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen?
The canonical SMILES for methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen is COC(=O)c1ccsc1-c1sccc1Br.[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].
What is the InChIKey of methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen?
The InChIKey is MDLAUBLANAOCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrO2S2.9H2/c1-13-10(12)6-2-4-14-8(6)9-7(11)3-5-15-9;;;;;;;;;/h2-5H,1H3;9*1H.
What are the key properties of methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen?
methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen has a molecular weight of 321.35 g/mol, XLogP of 6.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-bromothiophen-2-yl)thiophene-3-carboxylate;molecular hydrogen is sourced from PubChem (CID 167618862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).