C18H17ClN2O3 — CID 167619815
N-(2-chloro-5-methoxy-4-nitrophenyl)-6-methylidene-7,8-dihydro-5H-naphthalen-2-amine (PubChem CID 167619815) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is N-(2-chloro-5-methoxy-4-nitrophenyl)-6-methylidene-7,8-dihydro-5H-naphthalen-2-amine.
| Compound Name | N-(2-chloro-5-methoxy-4-nitrophenyl)-6-methylidene-7,8-dihydro-5H-naphthalen-2-amine |
|---|---|
| PubChem CID | 167619815 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-(2-chloro-5-methoxy-4-nitrophenyl)-6-methylidene-7,8-dihydro-5H-naphthalen-2-amine |
| SMILES | C=C1CCc2cc(Nc3cc(OC)c([N+](=O)[O-])cc3Cl)ccc2C1 |
| InChI | InChI=1S/C18H17ClN2O3/c1-11-3-4-13-8-14(6-5-12(13)7-11)20-16-10-18(24-2)17(21(22)23)9-15(16)19/h5-6,8-10,20H,1,3-4,7H2,2H3 |
| InChIKey | CUJKEKBCHBBBTH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|