C19H18FN5 — CID 167620701
2-(3-fluoro-2-pyridinyl)-6-isocyano-3-[(1S,3R)-3-methylcyclohexyl]imidazo[4,5-c]pyridine (PubChem CID 167620701) has the molecular formula C19H18FN5 and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-(3-fluoro-2-pyridinyl)-6-isocyano-3-[(1S,3R)-3-methylcyclohexyl]imidazo[4,5-c]pyridine.
| Compound Name | 2-(3-fluoro-2-pyridinyl)-6-isocyano-3-[(1S,3R)-3-methylcyclohexyl]imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 167620701 |
| Molecular Formula | C19H18FN5 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-(3-fluoro-2-pyridinyl)-6-isocyano-3-[(1S,3R)-3-methylcyclohexyl]imidazo[4,5-c]pyridine |
| SMILES | [C-]#[N+]c1cc2nc(-c3ncccc3F)n([C@H]3CCC[C@@H](C)C3)c2cn1 |
| InChI | InChI=1S/C19H18FN5/c1-12-5-3-6-13(9-12)25-16-11-23-17(21-2)10-15(16)24-19(25)18-14(20)7-4-8-22-18/h4,7-8,10-13H,3,5-6,9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | AEVSDIURWIZAPN-OLZOCXBDSA-N |
| XLogP | 4.93 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|