C18H18BrFN4 — CID 168886292
3-[6-bromo-2-(2-fluorophenyl)imidazo[4,5-c]pyridin-1-yl]cyclohexan-1-amine (PubChem CID 168886292) has the molecular formula C18H18BrFN4 and a molecular weight of 389.27 g/mol. Its IUPAC name is 3-[6-bromo-2-(2-fluorophenyl)imidazo[4,5-c]pyridin-1-yl]cyclohexan-1-amine.
| Compound Name | 3-[6-bromo-2-(2-fluorophenyl)imidazo[4,5-c]pyridin-1-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 168886292 |
| Molecular Formula | C18H18BrFN4 |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 3-[6-bromo-2-(2-fluorophenyl)imidazo[4,5-c]pyridin-1-yl]cyclohexan-1-amine |
| SMILES | NC1CCCC(n2c(-c3ccccc3F)nc3cnc(Br)cc32)C1 |
| InChI | InChI=1S/C18H18BrFN4/c19-17-9-16-15(10-22-17)23-18(13-6-1-2-7-14(13)20)24(16)12-5-3-4-11(21)8-12/h1-2,6-7,9-12H,3-5,8,21H2 |
| InChIKey | ACABOQWIZCQLPY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|