C23H22FN5 — CID 168886146
3-[2-(2-fluorophenyl)-6-pyrimidin-2-ylbenzimidazol-1-yl]cyclohexan-1-amine (PubChem CID 168886146) has the molecular formula C23H22FN5 and a molecular weight of 387.46 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)-6-pyrimidin-2-ylbenzimidazol-1-yl]cyclohexan-1-amine.
| Compound Name | 3-[2-(2-fluorophenyl)-6-pyrimidin-2-ylbenzimidazol-1-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 168886146 |
| Molecular Formula | C23H22FN5 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-[2-(2-fluorophenyl)-6-pyrimidin-2-ylbenzimidazol-1-yl]cyclohexan-1-amine |
| SMILES | NC1CCCC(n2c(-c3ccccc3F)nc3ccc(-c4ncccn4)cc32)C1 |
| InChI | InChI=1S/C23H22FN5/c24-19-8-2-1-7-18(19)23-28-20-10-9-15(22-26-11-4-12-27-22)13-21(20)29(23)17-6-3-5-16(25)14-17/h1-2,4,7-13,16-17H,3,5-6,14,25H2 |
| InChIKey | RQGNLIJPDDSZHN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |