C25H25FN2O2 — CID 167620757
N-[4-[3-fluoro-4-(3-pyridin-3-ylpropanoyl)phenyl]-3-methylphenyl]-N-methylpropanamide (PubChem CID 167620757) has the molecular formula C25H25FN2O2 and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[4-[3-fluoro-4-(3-pyridin-3-ylpropanoyl)phenyl]-3-methylphenyl]-N-methylpropanamide.
| Compound Name | N-[4-[3-fluoro-4-(3-pyridin-3-ylpropanoyl)phenyl]-3-methylphenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 167620757 |
| Molecular Formula | C25H25FN2O2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[4-[3-fluoro-4-(3-pyridin-3-ylpropanoyl)phenyl]-3-methylphenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1ccc(-c2ccc(C(=O)CCc3cccnc3)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C25H25FN2O2/c1-4-25(30)28(3)20-9-11-21(17(2)14-20)19-8-10-22(23(26)15-19)24(29)12-7-18-6-5-13-27-16-18/h5-6,8-11,13-16H,4,7,12H2,1-3H3 |
| InChIKey | MKDQBAXWZBMGMJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |