About tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane
tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane (PubChem CID 167625825) has the molecular formula C21H37F
and a molecular weight of 308.52 g/mol. Its IUPAC name is tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane.
Molecular Properties
| Compound Name | tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane |
| PubChem CID | 167625825 |
| Molecular Formula | C21H37F |
| Molecular Weight | 308.52 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane |
| SMILES | C.CC(C)(C)C1CCCCC1.CC(C)(C)c1ccccc1F |
| InChI | InChI=1S/C10H13F.C10H20.CH4/c1-10(2,3)8-6-4-5-7-9(8)11;1-10(2,3)9-7-5-4-6-8-9;/h4-7H,1-3H3;9H,4-8H2,1-3H3;1H4 |
| InChIKey | NBVKBHHFVMXMNR-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.52 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane?
The IUPAC name of tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane (CID 167625825) is tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane.
What is the SMILES notation for tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane?
The canonical SMILES for tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane is C.CC(C)(C)C1CCCCC1.CC(C)(C)c1ccccc1F.
What is the InChIKey of tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane?
The InChIKey is NBVKBHHFVMXMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F.C10H20.CH4/c1-10(2,3)8-6-4-5-7-9(8)11;1-10(2,3)9-7-5-4-6-8-9;/h4-7H,1-3H3;9H,4-8H2,1-3H3;1H4.
What are the key properties of tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane?
tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane has a molecular weight of 308.52 g/mol, XLogP of 7.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylcyclohexane;1-tert-butyl-2-fluorobenzene;methane is sourced from PubChem (CID 167625825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).