C17H25F2N — CID 65090003
4-tert-butyl-N-(2,6-difluorophenyl)cycloheptan-1-amine (PubChem CID 65090003) has the molecular formula C17H25F2N and a molecular weight of 281.39 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,6-difluorophenyl)cycloheptan-1-amine.
| Compound Name | 4-tert-butyl-N-(2,6-difluorophenyl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 65090003 |
| Molecular Formula | C17H25F2N |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 4-tert-butyl-N-(2,6-difluorophenyl)cycloheptan-1-amine |
| SMILES | CC(C)(C)C1CCCC(Nc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C17H25F2N/c1-17(2,3)12-6-4-7-13(11-10-12)20-16-14(18)8-5-9-15(16)19/h5,8-9,12-13,20H,4,6-7,10-11H2,1-3H3 |
| InChIKey | FAXLOASXQMWCBG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |