C14H11FN6O2 — CID 167630824
6-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyridazine-3-carboximidamide (PubChem CID 167630824) has the molecular formula C14H11FN6O2 and a molecular weight of 314.28 g/mol. Its IUPAC name is 6-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyridazine-3-carboximidamide.
| Compound Name | 6-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 167630824 |
| Molecular Formula | C14H11FN6O2 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 6-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]amino]-N'-hydroxypyridazine-3-carboximidamide |
| SMILES | NC(=NO)c1ccc(Nc2ncc(-c3ccc(F)cc3)o2)nn1 |
| InChI | InChI=1S/C14H11FN6O2/c15-9-3-1-8(2-4-9)11-7-17-14(23-11)18-12-6-5-10(19-20-12)13(16)21-22/h1-7,22H,(H2,16,21)(H,17,18,20) |
| InChIKey | NTSVURAMMHHSPM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|