C26H26FN5O4 — CID 167632942
1-[3-amino-2-[(2-fluoro-3-pyridinyl)methyl]prop-2-enylidene]-3-[(3S)-8-[2-(3-hydroxyoxetan-3-yl)ethynyl]-1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]urea (PubChem CID 167632942) has the molecular formula C26H26FN5O4 and a molecular weight of 491.52 g/mol. Its IUPAC name is 1-[3-amino-2-[(2-fluoro-3-pyridinyl)methyl]prop-2-enylidene]-3-[(3S)-8-[2-(3-hydroxyoxetan-3-yl)ethynyl]-1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]urea.
| Compound Name | 1-[3-amino-2-[(2-fluoro-3-pyridinyl)methyl]prop-2-enylidene]-3-[(3S)-8-[2-(3-hydroxyoxetan-3-yl)ethynyl]-1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]urea |
|---|---|
| PubChem CID | 167632942 |
| Molecular Formula | C26H26FN5O4 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 1-[3-amino-2-[(2-fluoro-3-pyridinyl)methyl]prop-2-enylidene]-3-[(3S)-8-[2-(3-hydroxyoxetan-3-yl)ethynyl]-1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]urea |
| SMILES | CN1C(=O)[C@@H](NC(=O)N=CC(=CN)Cc2cccnc2F)CCc2ccc(C#CC3(O)COC3)cc21 |
| InChI | InChI=1S/C26H26FN5O4/c1-32-22-12-17(8-9-26(35)15-36-16-26)4-5-19(22)6-7-21(24(32)33)31-25(34)30-14-18(13-28)11-20-3-2-10-29-23(20)27/h2-5,10,12-14,21,35H,6-7,11,15-16,28H2,1H3,(H,31,34)/t21-/m0/s1 |
| InChIKey | CHOZCBDBZPBDSL-NRFANRHFSA-N |
| XLogP | 1.48 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|