C27H28FN5O3 — CID 165161947
1-[(Z)-2-[(2-fluoro-3-pyridinyl)methyl]-3-iminoprop-1-enyl]-3-[(3R)-8-[2-(1-hydroxycyclobutyl)ethynyl]-1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]urea (PubChem CID 165161947) has the molecular formula C27H28FN5O3 and a molecular weight of 489.55 g/mol. Its IUPAC name is 1-[(Z)-2-[(2-fluoro-3-pyridinyl)methyl]-3-iminoprop-1-enyl]-3-[(3R)-8-[2-(1-hydroxycyclobutyl)ethynyl]-1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]urea.
| Compound Name | 1-[(Z)-2-[(2-fluoro-3-pyridinyl)methyl]-3-iminoprop-1-enyl]-3-[(3R)-8-[2-(1-hydroxycyclobutyl)ethynyl]-1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]urea |
|---|---|
| PubChem CID | 165161947 |
| Molecular Formula | C27H28FN5O3 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 1-[(Z)-2-[(2-fluoro-3-pyridinyl)methyl]-3-iminoprop-1-enyl]-3-[(3R)-8-[2-(1-hydroxycyclobutyl)ethynyl]-1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]urea |
| SMILES | [H]/N=C/C(=C\NC(=O)N[C@@H]1CCc2ccc(C#CC3(O)CCC3)cc2N(C)C1=O)Cc1cccnc1F |
| InChI | InChI=1S/C27H28FN5O3/c1-33-23-15-18(9-12-27(36)10-3-11-27)5-6-20(23)7-8-22(25(33)34)32-26(35)31-17-19(16-29)14-21-4-2-13-30-24(21)28/h2,4-6,13,15-17,22,29,36H,3,7-8,10-11,14H2,1H3,(H2,31,32,35)/b19-17-,29-16+/t22-/m1/s1 |
| InChIKey | DFJGCKWNAWFOEW-KFDPECROSA-N |
| XLogP | 2.84 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|