C20H24F2N2O — CID 167633430
9,11-difluoro-2,3,8,10-tetramethyl-2,4,4a,5,6,12c-hexahydro-1H-benzo[a][3,8]phenanthrolin-7-one (PubChem CID 167633430) has the molecular formula C20H24F2N2O and a molecular weight of 346.42 g/mol. Its IUPAC name is 9,11-difluoro-2,3,8,10-tetramethyl-2,4,4a,5,6,12c-hexahydro-1H-benzo[a][3,8]phenanthrolin-7-one.
| Compound Name | 9,11-difluoro-2,3,8,10-tetramethyl-2,4,4a,5,6,12c-hexahydro-1H-benzo[a][3,8]phenanthrolin-7-one |
|---|---|
| PubChem CID | 167633430 |
| Molecular Formula | C20H24F2N2O |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 9,11-difluoro-2,3,8,10-tetramethyl-2,4,4a,5,6,12c-hexahydro-1H-benzo[a][3,8]phenanthrolin-7-one |
| SMILES | Cc1c(F)cc2c3c(c(=O)n(C)c2c1F)CCC1CN(C)C(C)CC31 |
| InChI | InChI=1S/C20H24F2N2O/c1-10-7-14-12(9-23(10)3)5-6-13-17(14)15-8-16(21)11(2)18(22)19(15)24(4)20(13)25/h8,10,12,14H,5-7,9H2,1-4H3 |
| InChIKey | LEOXTSTZIMSPPY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |