C18H21ClFN3O2 — CID 167204108
16-chloro-14-fluoro-4,5,12,15-tetramethyl-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one (PubChem CID 167204108) has the molecular formula C18H21ClFN3O2 and a molecular weight of 365.84 g/mol. Its IUPAC name is 16-chloro-14-fluoro-4,5,12,15-tetramethyl-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one.
| Compound Name | 16-chloro-14-fluoro-4,5,12,15-tetramethyl-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one |
|---|---|
| PubChem CID | 167204108 |
| Molecular Formula | C18H21ClFN3O2 |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 16-chloro-14-fluoro-4,5,12,15-tetramethyl-9-oxa-2,5,12-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one |
| SMILES | Cc1c(Cl)cc2c3c(c(=O)n(C)c2c1F)OCC1CN(C)C(C)CN31 |
| InChI | InChI=1S/C18H21ClFN3O2/c1-9-6-23-11(7-21(9)3)8-25-17-16(23)12-5-13(19)10(2)14(20)15(12)22(4)18(17)24/h5,9,11H,6-8H2,1-4H3 |
| InChIKey | MASKOGXQWXYMIS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |