C20H26FN5O2 — CID 167204042
16-fluoro-4,5,12,15-tetramethyl-9-(oxetan-3-yl)-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one (PubChem CID 167204042) has the molecular formula C20H26FN5O2 and a molecular weight of 387.46 g/mol. Its IUPAC name is 16-fluoro-4,5,12,15-tetramethyl-9-(oxetan-3-yl)-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one.
| Compound Name | 16-fluoro-4,5,12,15-tetramethyl-9-(oxetan-3-yl)-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one |
|---|---|
| PubChem CID | 167204042 |
| Molecular Formula | C20H26FN5O2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 16-fluoro-4,5,12,15-tetramethyl-9-(oxetan-3-yl)-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one |
| SMILES | Cc1nc2c(cc1F)c1c(c(=O)n2C)N(C2COC2)CC2CN(C)C(C)CN12 |
| InChI | InChI=1S/C20H26FN5O2/c1-11-6-25-13(7-23(11)3)8-26(14-9-28-10-14)18-17(25)15-5-16(21)12(2)22-19(15)24(4)20(18)27/h5,11,13-14H,6-10H2,1-4H3 |
| InChIKey | BYTUHEADEVKUEW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |