C15H17FIN5O2 — CID 167104718
11-fluoro-15-iodo-4,5,12-trimethyl-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one (PubChem CID 167104718) has the molecular formula C15H17FIN5O2 and a molecular weight of 445.24 g/mol. Its IUPAC name is 11-fluoro-15-iodo-4,5,12-trimethyl-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one.
| Compound Name | 11-fluoro-15-iodo-4,5,12-trimethyl-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one |
|---|---|
| PubChem CID | 167104718 |
| Molecular Formula | C15H17FIN5O2 |
| Molecular Weight | 445.24 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 11-fluoro-15-iodo-4,5,12-trimethyl-9-oxa-2,5,13,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one |
| SMILES | Cc1nc2c3c(nc(=O)n2I)N2CC(C)N(C)CC2COc3c1F |
| InChI | InChI=1S/C15H17FIN5O2/c1-7-4-21-9(5-20(7)3)6-24-12-10-13(21)19-15(23)22(17)14(10)18-8(2)11(12)16/h7,9H,4-6H2,1-3H3 |
| InChIKey | MQPYECKVCNPNKN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|