C16H17F2I2N5O — CID 167104607
11,13-difluoro-5,15-diiodo-4,9,12-trimethyl-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 167104607) has the molecular formula C16H17F2I2N5O and a molecular weight of 587.15 g/mol. Its IUPAC name is 11,13-difluoro-5,15-diiodo-4,9,12-trimethyl-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | 11,13-difluoro-5,15-diiodo-4,9,12-trimethyl-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 167104607 |
| Molecular Formula | C16H17F2I2N5O |
| Molecular Weight | 587.15 g/mol |
| Exact Mass | 586.95 |
| IUPAC Name | 11,13-difluoro-5,15-diiodo-4,9,12-trimethyl-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | Cc1c(F)c2c3c(nc(=O)n(I)c3c1F)N1CC(C)N(I)CC1CN2C |
| InChI | InChI=1S/C16H17F2I2N5O/c1-7-4-23-9(6-24(7)19)5-22(3)13-10-14(12(18)8(2)11(13)17)25(20)16(26)21-15(10)23/h7,9H,4-6H2,1-3H3 |
| InChIKey | QXXFLKNBNMMQGN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.15 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|