C15H18FIN6O — CID 167104745
12-fluoro-16-iodo-5,13-dimethyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one (PubChem CID 167104745) has the molecular formula C15H18FIN6O and a molecular weight of 444.25 g/mol. Its IUPAC name is 12-fluoro-16-iodo-5,13-dimethyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one.
| Compound Name | 12-fluoro-16-iodo-5,13-dimethyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one |
|---|---|
| PubChem CID | 167104745 |
| Molecular Formula | C15H18FIN6O |
| Molecular Weight | 444.25 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 12-fluoro-16-iodo-5,13-dimethyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one |
| SMILES | Cc1nc2c3c(nc(=O)n2I)N2CCN(C)CC2CCNc3c1F |
| InChI | InChI=1S/C15H18FIN6O/c1-8-11(16)12-10-13(20-15(24)23(17)14(10)19-8)22-6-5-21(2)7-9(22)3-4-18-12/h9,18H,3-7H2,1-2H3 |
| InChIKey | XJNPAJYFEVSXGH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|