C18H22F2IN5O — CID 167104588
12,14-difluoro-16-iodo-3,5,10,13-tetramethyl-2,5,10,16,18-pentazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11,13,15(19)-tetraen-17-one (PubChem CID 167104588) has the molecular formula C18H22F2IN5O and a molecular weight of 489.31 g/mol. Its IUPAC name is 12,14-difluoro-16-iodo-3,5,10,13-tetramethyl-2,5,10,16,18-pentazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11,13,15(19)-tetraen-17-one.
| Compound Name | 12,14-difluoro-16-iodo-3,5,10,13-tetramethyl-2,5,10,16,18-pentazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11,13,15(19)-tetraen-17-one |
|---|---|
| PubChem CID | 167104588 |
| Molecular Formula | C18H22F2IN5O |
| Molecular Weight | 489.31 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | 12,14-difluoro-16-iodo-3,5,10,13-tetramethyl-2,5,10,16,18-pentazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11,13,15(19)-tetraen-17-one |
| SMILES | Cc1c(F)c2c3c(nc(=O)n(I)c3c1F)N1C(C)CN(C)CC1CCN2C |
| InChI | InChI=1S/C18H22F2IN5O/c1-9-7-23(3)8-11-5-6-24(4)15-12-16(14(20)10(2)13(15)19)26(21)18(27)22-17(12)25(9)11/h9,11H,5-8H2,1-4H3 |
| InChIKey | SRGJDBZKTMGKDG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|