C15H15FI2N4O3S — CID 167104892
11-fluoro-5,15-diiodo-4,12-dimethyl-9,9-dioxo-9λ6-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 167104892) has the molecular formula C15H15FI2N4O3S and a molecular weight of 604.18 g/mol. Its IUPAC name is 11-fluoro-5,15-diiodo-4,12-dimethyl-9,9-dioxo-9λ6-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | 11-fluoro-5,15-diiodo-4,12-dimethyl-9,9-dioxo-9λ6-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 167104892 |
| Molecular Formula | C15H15FI2N4O3S |
| Molecular Weight | 604.18 g/mol |
| Exact Mass | 603.89 |
| IUPAC Name | 11-fluoro-5,15-diiodo-4,12-dimethyl-9,9-dioxo-9λ6-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | Cc1cc2c3c(nc(=O)n2I)N2CC(C)N(I)CC2CS(=O)(=O)c3c1F |
| InChI | InChI=1S/C15H15FI2N4O3S/c1-7-3-10-11-13(12(7)16)26(24,25)6-9-5-21(17)8(2)4-20(9)14(11)19-15(23)22(10)18/h3,8-9H,4-6H2,1-2H3 |
| InChIKey | LUDSIKVDICCLFQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|