C16H18FIN4OS — CID 167105075
11-fluoro-15-iodo-4,5,12-trimethyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 167105075) has the molecular formula C16H18FIN4OS and a molecular weight of 460.32 g/mol. Its IUPAC name is 11-fluoro-15-iodo-4,5,12-trimethyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | 11-fluoro-15-iodo-4,5,12-trimethyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 167105075 |
| Molecular Formula | C16H18FIN4OS |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | 11-fluoro-15-iodo-4,5,12-trimethyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | Cc1cc2c3c(nc(=O)n2I)N2CC(C)N(C)CC2CSc3c1F |
| InChI | InChI=1S/C16H18FIN4OS/c1-8-4-11-12-14(13(8)17)24-7-10-6-20(3)9(2)5-21(10)15(12)19-16(23)22(11)18/h4,9-10H,5-7H2,1-3H3 |
| InChIKey | AFCYFOMVUDSVQY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|