C17H23FN6O — CID 167226938
11-fluoro-3,5,9,12,15-pentamethyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one (PubChem CID 167226938) has the molecular formula C17H23FN6O and a molecular weight of 346.41 g/mol. Its IUPAC name is 11-fluoro-3,5,9,12,15-pentamethyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one.
| Compound Name | 11-fluoro-3,5,9,12,15-pentamethyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one |
|---|---|
| PubChem CID | 167226938 |
| Molecular Formula | C17H23FN6O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 11-fluoro-3,5,9,12,15-pentamethyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one |
| SMILES | Cc1nc2c3c(nc(=O)n2C)N2C(C)CN(C)CC2CN(C)c3c1F |
| InChI | InChI=1S/C17H23FN6O/c1-9-6-21(3)7-11-8-22(4)14-12-15(19-10(2)13(14)18)23(5)17(25)20-16(12)24(9)11/h9,11H,6-8H2,1-5H3 |
| InChIKey | XNKHWXDJUAAVAP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |