C19H26FN5 — CID 167600472
11-fluoro-3,5,9,12,15-pentamethyl-16-methylidene-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraene (PubChem CID 167600472) has the molecular formula C19H26FN5 and a molecular weight of 343.45 g/mol. Its IUPAC name is 11-fluoro-3,5,9,12,15-pentamethyl-16-methylidene-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraene.
| Compound Name | 11-fluoro-3,5,9,12,15-pentamethyl-16-methylidene-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraene |
|---|---|
| PubChem CID | 167600472 |
| Molecular Formula | C19H26FN5 |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 11-fluoro-3,5,9,12,15-pentamethyl-16-methylidene-2,5,9,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraene |
| SMILES | C=C1N=C2c3c(cc(C)c(F)c3N(C)CC3CN(C)CC(C)N23)N1C |
| InChI | InChI=1S/C19H26FN5/c1-11-7-15-16-18(17(11)20)23(5)10-14-9-22(4)8-12(2)25(14)19(16)21-13(3)24(15)6/h7,12,14H,3,8-10H2,1-2,4-6H3 |
| InChIKey | NDCRWNXSMKDAMT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 25.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |