C12H16ClFIN3 — CID 139405262
(2R,6S)-1-(5-chloro-6-fluoro-4-iodo-2-pyridinyl)-2,4,6-trimethylpiperazine (PubChem CID 139405262) has the molecular formula C12H16ClFIN3 and a molecular weight of 383.64 g/mol. Its IUPAC name is (2R,6S)-1-(5-chloro-6-fluoro-4-iodo-2-pyridinyl)-2,4,6-trimethylpiperazine.
| Compound Name | (2R,6S)-1-(5-chloro-6-fluoro-4-iodo-2-pyridinyl)-2,4,6-trimethylpiperazine |
|---|---|
| PubChem CID | 139405262 |
| Molecular Formula | C12H16ClFIN3 |
| Molecular Weight | 383.64 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | (2R,6S)-1-(5-chloro-6-fluoro-4-iodo-2-pyridinyl)-2,4,6-trimethylpiperazine |
| SMILES | C[C@@H]1CN(C)C[C@H](C)N1c1cc(I)c(Cl)c(F)n1 |
| InChI | InChI=1S/C12H16ClFIN3/c1-7-5-17(3)6-8(2)18(7)10-4-9(15)11(13)12(14)16-10/h4,7-8H,5-6H2,1-3H3/t7-,8+ |
| InChIKey | RIVATECYXPGGQH-OCAPTIKFSA-N |
| XLogP | 3.01 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|