C12H18ClFN4 — CID 139405504
3-chloro-6-[(2S)-4-ethyl-2-methylpiperazin-1-yl]-2-fluoropyridin-4-amine (PubChem CID 139405504) has the molecular formula C12H18ClFN4 and a molecular weight of 272.75 g/mol. Its IUPAC name is 3-chloro-6-[(2S)-4-ethyl-2-methylpiperazin-1-yl]-2-fluoropyridin-4-amine.
| Compound Name | 3-chloro-6-[(2S)-4-ethyl-2-methylpiperazin-1-yl]-2-fluoropyridin-4-amine |
|---|---|
| PubChem CID | 139405504 |
| Molecular Formula | C12H18ClFN4 |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-chloro-6-[(2S)-4-ethyl-2-methylpiperazin-1-yl]-2-fluoropyridin-4-amine |
| SMILES | CCN1CCN(c2cc(N)c(Cl)c(F)n2)[C@@H](C)C1 |
| InChI | InChI=1S/C12H18ClFN4/c1-3-17-4-5-18(8(2)7-17)10-6-9(15)11(13)12(14)16-10/h6,8H,3-5,7H2,1-2H3,(H2,15,16)/t8-/m0/s1 |
| InChIKey | ZHBQCAJCVSEVSB-QMMMGPOBSA-N |
| XLogP | 1.99 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|