C12H16ClFN4O2 — CID 155227649
[3-chloro-6-(2,4-dimethylpiperazin-1-yl)-2-fluoro-4-pyridinyl]carbamic acid (PubChem CID 155227649) has the molecular formula C12H16ClFN4O2 and a molecular weight of 302.74 g/mol. Its IUPAC name is [3-chloro-6-(2,4-dimethylpiperazin-1-yl)-2-fluoro-4-pyridinyl]carbamic acid.
| Compound Name | [3-chloro-6-(2,4-dimethylpiperazin-1-yl)-2-fluoro-4-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 155227649 |
| Molecular Formula | C12H16ClFN4O2 |
| Molecular Weight | 302.74 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [3-chloro-6-(2,4-dimethylpiperazin-1-yl)-2-fluoro-4-pyridinyl]carbamic acid |
| SMILES | CC1CN(C)CCN1c1cc(NC(=O)O)c(Cl)c(F)n1 |
| InChI | InChI=1S/C12H16ClFN4O2/c1-7-6-17(2)3-4-18(7)9-5-8(15-12(19)20)10(13)11(14)16-9/h5,7H,3-4,6H2,1-2H3,(H,15,16)(H,19,20) |
| InChIKey | PNKSWEBUIFZXOV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.74 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|